C9H23N3S — CID 123468608
1-[ethyl(dimethyl)-λ4-sulfanyl]-1,2,3,3-tetramethylguanidine (PubChem CID 123468608) has the molecular formula C9H23N3S and a molecular weight of 205.37 g/mol. Its IUPAC name is 1-[ethyl(dimethyl)-λ4-sulfanyl]-1,2,3,3-tetramethylguanidine.
| Compound Name | 1-[ethyl(dimethyl)-λ4-sulfanyl]-1,2,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 123468608 |
| Molecular Formula | C9H23N3S |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-[ethyl(dimethyl)-λ4-sulfanyl]-1,2,3,3-tetramethylguanidine |
| SMILES | CCS(C)(C)N(C)/C(=N/C)N(C)C |
| InChI | InChI=1S/C9H23N3S/c1-8-13(6,7)12(5)9(10-2)11(3)4/h8H2,1-7H3/b10-9+ |
| InChIKey | QLGMZQYLKGSJSS-MDZDMXLPSA-N |
| XLogP | 1.46 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|