About 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane
2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane (PubChem CID 123468958) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane.
Analyze 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane?
The IUPAC name of 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane (CID 123468958) is 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane.
What is the SMILES notation for 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane?
The canonical SMILES for 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane is CC1CC2CC3C(C)C4CC1C31C2CC41.
What is the InChIKey of 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane?
The InChIKey is DPQLFSIWBPDCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-7-3-9-4-12-8(2)10-5-11(7)15(12)13(9)6-14(10)15/h7-14H,3-6H2,1-2H3.
What are the key properties of 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane?
2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane has a molecular weight of 202.34 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylpentacyclo[6.4.1.03,9.05,10.09,12]tridecane is sourced from PubChem (CID 123468958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).