C25H18F6N2O3 — CID 123469160
3-[[1-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 123469160) has the molecular formula C25H18F6N2O3 and a molecular weight of 508.42 g/mol. Its IUPAC name is 3-[[1-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | 3-[[1-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 123469160 |
| Molecular Formula | C25H18F6N2O3 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 3-[[1-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | CC1=CC(OC=C2C(=O)NC3c4ccccc4CC23)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C25H18F6N2O3/c1-12-6-20(36-11-19-18-7-13-4-2-3-5-17(13)21(18)32-22(19)34)33(23(12)35)16-9-14(24(26,27)28)8-15(10-16)25(29,30)31/h2-6,8-11,18,20-21H,7H2,1H3,(H,32,34) |
| InChIKey | CVBUGCZYDFSXOZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|