C29H40ClN5O3 — CID 123469265
2-[[1-[1-[(4-chloro-3-methylphenyl)methyl]piperidin-4-yl]-5-oxopyrrolidin-2-yl]methoxymethylamino]-6-ethyl-N,N-dimethylpyridine-4-carboxamide (PubChem CID 123469265) has the molecular formula C29H40ClN5O3 and a molecular weight of 542.12 g/mol. Its IUPAC name is 2-[[1-[1-[(4-chloro-3-methylphenyl)methyl]piperidin-4-yl]-5-oxopyrrolidin-2-yl]methoxymethylamino]-6-ethyl-N,N-dimethylpyridine-4-carboxamide.
| Compound Name | 2-[[1-[1-[(4-chloro-3-methylphenyl)methyl]piperidin-4-yl]-5-oxopyrrolidin-2-yl]methoxymethylamino]-6-ethyl-N,N-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 123469265 |
| Molecular Formula | C29H40ClN5O3 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 2-[[1-[1-[(4-chloro-3-methylphenyl)methyl]piperidin-4-yl]-5-oxopyrrolidin-2-yl]methoxymethylamino]-6-ethyl-N,N-dimethylpyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)N(C)C)cc(NCOCC2CCC(=O)N2C2CCN(Cc3ccc(Cl)c(C)c3)CC2)n1 |
| InChI | InChI=1S/C29H40ClN5O3/c1-5-23-15-22(29(37)33(3)4)16-27(32-23)31-19-38-18-25-7-9-28(36)35(25)24-10-12-34(13-11-24)17-21-6-8-26(30)20(2)14-21/h6,8,14-16,24-25H,5,7,9-13,17-19H2,1-4H3,(H,31,32) |
| InChIKey | VMYWLMKXSHAWJW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|