C9H11N3O2 — CID 123469344
1-(6-oxo-1H-pyridin-3-yl)piperazin-2-one (PubChem CID 123469344) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(6-oxo-1H-pyridin-3-yl)piperazin-2-one.
| Compound Name | 1-(6-oxo-1H-pyridin-3-yl)piperazin-2-one |
|---|---|
| PubChem CID | 123469344 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(6-oxo-1H-pyridin-3-yl)piperazin-2-one |
| SMILES | O=C1CNCCN1c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C9H11N3O2/c13-8-2-1-7(5-11-8)12-4-3-10-6-9(12)14/h1-2,5,10H,3-4,6H2,(H,11,13) |
| InChIKey | IMMUJWJBBMCNRH-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |