C19H24F2O — CID 123469345
4-[2-(3,4-difluorophenyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methylbutan-2-ol (PubChem CID 123469345) has the molecular formula C19H24F2O and a molecular weight of 306.40 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methylbutan-2-ol.
| Compound Name | 4-[2-(3,4-difluorophenyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 123469345 |
| Molecular Formula | C19H24F2O |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methylbutan-2-ol |
| SMILES | CC1=C(C)CC(c2ccc(F)c(F)c2)=C(CCC(C)(C)O)C1 |
| InChI | InChI=1S/C19H24F2O/c1-12-9-15(7-8-19(3,4)22)16(10-13(12)2)14-5-6-17(20)18(21)11-14/h5-6,11,22H,7-10H2,1-4H3 |
| InChIKey | XIRNQUGXUZFHRS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|