C30H41O3P — CID 123469420
[[3-(2,3-dimethylbut-2-enyl)-2,4,6-trimethylbenzoyl]-(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 123469420) has the molecular formula C30H41O3P and a molecular weight of 480.63 g/mol. Its IUPAC name is [[3-(2,3-dimethylbut-2-enyl)-2,4,6-trimethylbenzoyl]-(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [[3-(2,3-dimethylbut-2-enyl)-2,4,6-trimethylbenzoyl]-(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 123469420 |
| Molecular Formula | C30H41O3P |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | [[3-(2,3-dimethylbut-2-enyl)-2,4,6-trimethylbenzoyl]-(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CC(C)=C(C)Cc1c(C)cc(C)c(C(=O)P(=O)(CC(C)C)C(=O)c2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C30H41O3P/c1-17(2)16-34(33,29(31)27-22(8)12-19(5)13-23(27)9)30(32)28-24(10)14-21(7)26(25(28)11)15-20(6)18(3)4/h12-14,17H,15-16H2,1-11H3 |
| InChIKey | BPEDZWVQSHYEAS-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|