About 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one
3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one (PubChem CID 123469741) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 123469741 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one |
| SMILES | CC=CC1=C(C)CNC1=O |
| InChI | InChI=1S/C8H11NO/c1-3-4-7-6(2)5-9-8(7)10/h3-4H,5H2,1-2H3,(H,9,10) |
| InChIKey | NARQJBKCHHABCB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one (CID 123469741) is 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one is CC=CC1=C(C)CNC1=O.
What is the InChIKey of 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one?
The InChIKey is NARQJBKCHHABCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-4-7-6(2)5-9-8(7)10/h3-4H,5H2,1-2H3,(H,9,10).
What are the key properties of 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one?
3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one has a molecular weight of 137.18 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-prop-1-enyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 123469741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).