About 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine
6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine (PubChem CID 123469783) has the molecular formula C20H40N2
and a molecular weight of 308.55 g/mol. Its IUPAC name is 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine.
Molecular Properties
| Compound Name | 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine |
| PubChem CID | 123469783 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine |
| SMILES | C=C(C)C(C)CCC(C)/N=C(\CCCC)CCCC(C)NC |
| InChI | InChI=1S/C20H40N2/c1-8-9-12-20(13-10-11-18(5)21-7)22-19(6)15-14-17(4)16(2)3/h17-19,21H,2,8-15H2,1,3-7H3/b22-20+ |
| InChIKey | ZDIBNMLVJIMVLB-LSDHQDQOSA-N |
| XLogP | 5.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine?
The IUPAC name of 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine (CID 123469783) is 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine.
What is the SMILES notation for 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine?
The canonical SMILES for 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine is C=C(C)C(C)CCC(C)/N=C(\CCCC)CCCC(C)NC.
What is the InChIKey of 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine?
The InChIKey is ZDIBNMLVJIMVLB-LSDHQDQOSA-N. The full InChI is InChI=1S/C20H40N2/c1-8-9-12-20(13-10-11-18(5)21-7)22-19(6)15-14-17(4)16(2)3/h17-19,21H,2,8-15H2,1,3-7H3/b22-20+.
What are the key properties of 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine?
6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine has a molecular weight of 308.55 g/mol, XLogP of 5.78, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-dimethylhept-6-en-2-ylimino)-N-methyldecan-2-amine is sourced from PubChem (CID 123469783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).