About 2-chlorooctane
2-chlorooctane (PubChem CID 12347) has the molecular formula C8H17Cl
and a molecular weight of 148.68 g/mol. Its IUPAC name is 2-chlorooctane.
Molecular Properties
| Compound Name | 2-chlorooctane |
| PubChem CID | 12347 |
| Molecular Formula | C8H17Cl |
| Molecular Weight | 148.68 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-chlorooctane |
| SMILES | CCCCCCC(C)Cl |
| InChI | InChI=1S/C8H17Cl/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
| InChIKey | HKDCIIMOALDWHF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorooctane?
The IUPAC name of 2-chlorooctane (CID 12347) is 2-chlorooctane.
What is the SMILES notation for 2-chlorooctane?
The canonical SMILES for 2-chlorooctane is CCCCCCC(C)Cl.
What is the InChIKey of 2-chlorooctane?
The InChIKey is HKDCIIMOALDWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Cl/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3.
What are the key properties of 2-chlorooctane?
2-chlorooctane has a molecular weight of 148.68 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorooctane is sourced from PubChem (CID 12347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).