C17H21F6NO2 — CID 123470625
N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-methylphenyl]methyl]-N-methylprop-2-en-1-amine (PubChem CID 123470625) has the molecular formula C17H21F6NO2 and a molecular weight of 385.35 g/mol. Its IUPAC name is N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-methylphenyl]methyl]-N-methylprop-2-en-1-amine.
| Compound Name | N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-methylphenyl]methyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 123470625 |
| Molecular Formula | C17H21F6NO2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-methylphenyl]methyl]-N-methylprop-2-en-1-amine |
| SMILES | C=CCN(C)Cc1ccc(C)c(C(OCOC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F6NO2/c1-5-8-24(3)10-13-7-6-12(2)14(9-13)15(16(18,19)20,17(21,22)23)26-11-25-4/h5-7,9H,1,8,10-11H2,2-4H3 |
| InChIKey | LXRKQRXBCOHINS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|