C29H28FN4O3+ — CID 123470865
2-benzyl-7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123470865) has the molecular formula C29H28FN4O3+ and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-benzyl-7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 2-benzyl-7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123470865 |
| Molecular Formula | C29H28FN4O3+ |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-benzyl-7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | CC(C)C1=CC(c2ccc(F)cc2)=[N+]2C=C(C(=O)N3CCN4C(=O)C(Cc5ccccc5)OC4C3)N=C12 |
| InChI | InChI=1S/C29H28FN4O3/c1-18(2)22-15-24(20-8-10-21(30)11-9-20)34-16-23(31-27(22)34)28(35)32-12-13-33-26(17-32)37-25(29(33)36)14-19-6-4-3-5-7-19/h3-11,15-16,18,25-26H,12-14,17H2,1-2H3/q+1 |
| InChIKey | XLCOKAJSWCHWNQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|