C26H30F3N3O3 — CID 123471016
4-[4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidin-5-yl]-1-methyl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 123471016) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is 4-[4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidin-5-yl]-1-methyl-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 4-[4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidin-5-yl]-1-methyl-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 123471016 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 4-[4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidin-5-yl]-1-methyl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | C=C(CC)C(=CC=C(C)OC)C1CC1COc1nc(C)ncc1-c1cc(=O)n(C)cc1C(F)(F)F |
| InChI | InChI=1S/C26H30F3N3O3/c1-7-15(2)19(9-8-16(3)34-6)20-10-18(20)14-35-25-22(12-30-17(4)31-25)21-11-24(33)32(5)13-23(21)26(27,28)29/h8-9,11-13,18,20H,2,7,10,14H2,1,3-6H3 |
| InChIKey | CADAQIPFUWJTBV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|