C29H31N3O2 — CID 123471044
4-(2-cyanophenoxy)-3-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 123471044) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 4-(2-cyanophenoxy)-3-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 4-(2-cyanophenoxy)-3-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 123471044 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 4-(2-cyanophenoxy)-3-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Oc3ccccc3C#N)c(-c3ccccc3)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C29H31N3O2/c1-28(2)17-23(18-29(3,4)32-28)31-27(33)21-14-15-26(24(16-21)20-10-6-5-7-11-20)34-25-13-9-8-12-22(25)19-30/h5-16,23,32H,17-18H2,1-4H3,(H,31,33) |
| InChIKey | PDGKYWWWXIXCBJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |