About methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate
methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate (PubChem CID 123471280) has the molecular formula C8H11N3O2S
and a molecular weight of 213.26 g/mol. Its IUPAC name is methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate |
| PubChem CID | 123471280 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate |
| SMILES | C/N=C(/NC(=O)c1ocnc1C)SC |
| InChI | InChI=1S/C8H11N3O2S/c1-5-6(13-4-10-5)7(12)11-8(9-2)14-3/h4H,1-3H3,(H,9,11,12) |
| InChIKey | KVUZNVUUAARFSN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate?
The IUPAC name of methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate (CID 123471280) is methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate.
What is the SMILES notation for methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate?
The canonical SMILES for methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate is C/N=C(/NC(=O)c1ocnc1C)SC.
What is the InChIKey of methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate?
The InChIKey is KVUZNVUUAARFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2S/c1-5-6(13-4-10-5)7(12)11-8(9-2)14-3/h4H,1-3H3,(H,9,11,12).
What are the key properties of methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate?
methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate has a molecular weight of 213.26 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-methyl-N-(4-methyl-1,3-oxazole-5-carbonyl)carbamimidothioate is sourced from PubChem (CID 123471280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).