About (2-silyloxan-2-yl)silane
(2-silyloxan-2-yl)silane (PubChem CID 123472748) has the molecular formula C5H14OSi2
and a molecular weight of 146.34 g/mol. Its IUPAC name is (2-silyloxan-2-yl)silane.
Molecular Properties
| Compound Name | (2-silyloxan-2-yl)silane |
|---|
| PubChem CID | 123472748 |
|---|
| Molecular Formula | C5H14OSi2 |
|---|
| Molecular Weight | 146.34 g/mol |
|---|
| Exact Mass | 146.06 |
|---|
| IUPAC Name | (2-silyloxan-2-yl)silane |
|---|
| SMILES | [SiH3]C1([SiH3])CCCCO1 |
|---|
| InChI | InChI=1S/C5H14OSi2/c7-5(8)3-1-2-4-6-5/h1-4H2,7-8H3 |
|---|
| InChIKey | XZINTHSUEATTLI-UHFFFAOYSA-N |
|---|
| XLogP | -1.43 |
|---|
| TPSA | 9.23 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 146.34 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-silyloxan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-silyloxan-2-yl)silane?
The IUPAC name of (2-silyloxan-2-yl)silane (CID 123472748) is (2-silyloxan-2-yl)silane.
What is the SMILES notation for (2-silyloxan-2-yl)silane?
The canonical SMILES for (2-silyloxan-2-yl)silane is [SiH3]C1([SiH3])CCCCO1.
What is the InChIKey of (2-silyloxan-2-yl)silane?
The InChIKey is XZINTHSUEATTLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14OSi2/c7-5(8)3-1-2-4-6-5/h1-4H2,7-8H3.
What are the key properties of (2-silyloxan-2-yl)silane?
(2-silyloxan-2-yl)silane has a molecular weight of 146.34 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-silyloxan-2-yl)silane is sourced from PubChem (CID 123472748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).