C22H27NO4S — CID 123472796
tert-butyl 2-[4-ethyl-3-[3-(2-hydroxyethoxy)prop-1-ynyl]cyclohepta-1,3,6-trien-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 123472796) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl 2-[4-ethyl-3-[3-(2-hydroxyethoxy)prop-1-ynyl]cyclohepta-1,3,6-trien-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 2-[4-ethyl-3-[3-(2-hydroxyethoxy)prop-1-ynyl]cyclohepta-1,3,6-trien-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 123472796 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl 2-[4-ethyl-3-[3-(2-hydroxyethoxy)prop-1-ynyl]cyclohepta-1,3,6-trien-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCC1=C(C#CCOCCO)C=C(c2nc(C(=O)OC(C)(C)C)cs2)C=CC1 |
| InChI | InChI=1S/C22H27NO4S/c1-5-16-8-6-9-18(14-17(16)10-7-12-26-13-11-24)20-23-19(15-28-20)21(25)27-22(2,3)4/h6,9,14-15,24H,5,8,11-13H2,1-4H3 |
| InChIKey | YHRMROODSMNSGO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|