C32H22F4N3O2+3 — CID 123472807
11',13',25',27'-tetrafluorospiro[3H-pyrido[2,1-c][1,4]oxazin-5-ium-4,21'-7,20-diazoniapentacyclo[21.4.0.02,7.09,14.015,20]heptacosa-1(23),2,4,6,9(14),10,12,15,17,19,24,26-dodecaene]-1-one (PubChem CID 123472807) has the molecular formula C32H22F4N3O2+3 and a molecular weight of 556.54 g/mol. Its IUPAC name is 11',13',25',27'-tetrafluorospiro[3H-pyrido[2,1-c][1,4]oxazin-5-ium-4,21'-7,20-diazoniapentacyclo[21.4.0.02,7.09,14.015,20]heptacosa-1(23),2,4,6,9(14),10,12,15,17,19,24,26-dodecaene]-1-one.
| Compound Name | 11',13',25',27'-tetrafluorospiro[3H-pyrido[2,1-c][1,4]oxazin-5-ium-4,21'-7,20-diazoniapentacyclo[21.4.0.02,7.09,14.015,20]heptacosa-1(23),2,4,6,9(14),10,12,15,17,19,24,26-dodecaene]-1-one |
|---|---|
| PubChem CID | 123472807 |
| Molecular Formula | C32H22F4N3O2+3 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 11',13',25',27'-tetrafluorospiro[3H-pyrido[2,1-c][1,4]oxazin-5-ium-4,21'-7,20-diazoniapentacyclo[21.4.0.02,7.09,14.015,20]heptacosa-1(23),2,4,6,9(14),10,12,15,17,19,24,26-dodecaene]-1-one |
| SMILES | O=C1OCC2(Cc3cc(F)cc(F)c3-c3cccc[n+]3Cc3cc(F)cc(F)c3-c3cccc[n+]32)[n+]2ccccc21 |
| InChI | InChI=1S/C32H22F4N3O2/c33-22-13-20-17-32(19-41-31(40)28-9-3-6-12-39(28)32)38-11-5-2-8-27(38)30-21(14-23(34)16-25(30)36)18-37-10-4-1-7-26(37)29(20)24(35)15-22/h1-16H,17-19H2/q+3 |
| InChIKey | XJKKQJHBFKZBAV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|