C37H36Cl2N4O3S — CID 123473425
5-[3-[4-(2,4-dichlorophenyl)-2-[[4-[3-(4,4-dimethylpentyl)phenyl]phenyl]methyl]imidazol-1-yl]phenyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol (PubChem CID 123473425) has the molecular formula C37H36Cl2N4O3S and a molecular weight of 687.69 g/mol. Its IUPAC name is 5-[3-[4-(2,4-dichlorophenyl)-2-[[4-[3-(4,4-dimethylpentyl)phenyl]phenyl]methyl]imidazol-1-yl]phenyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol.
| Compound Name | 5-[3-[4-(2,4-dichlorophenyl)-2-[[4-[3-(4,4-dimethylpentyl)phenyl]phenyl]methyl]imidazol-1-yl]phenyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
|---|---|
| PubChem CID | 123473425 |
| Molecular Formula | C37H36Cl2N4O3S |
| Molecular Weight | 687.69 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | 5-[3-[4-(2,4-dichlorophenyl)-2-[[4-[3-(4,4-dimethylpentyl)phenyl]phenyl]methyl]imidazol-1-yl]phenyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
| SMILES | CC(C)(C)CCCc1cccc(-c2ccc(Cc3nc(-c4ccc(Cl)cc4Cl)cn3-c3cccc(N4C=C(O)NS4(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C37H36Cl2N4O3S/c1-37(2,3)18-6-8-25-7-4-9-28(19-25)27-14-12-26(13-15-27)20-35-40-34(32-17-16-29(38)21-33(32)39)23-42(35)30-10-5-11-31(22-30)43-24-36(44)41-47(43,45)46/h4-5,7,9-17,19,21-24,41,44H,6,8,18,20H2,1-3H3 |
| InChIKey | BKLQXYOGFKJUHN-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.69 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |