C35H62O4 — CID 123473451
1-[2-(4-cyclohexylcyclohex-2-en-1-yl)oxyethoxy]ethoxy-[2-methyl-4-(2,2,5,5-tetramethylheptan-3-yl)cyclohexen-1-yl]methanol (PubChem CID 123473451) has the molecular formula C35H62O4 and a molecular weight of 546.88 g/mol. Its IUPAC name is 1-[2-(4-cyclohexylcyclohex-2-en-1-yl)oxyethoxy]ethoxy-[2-methyl-4-(2,2,5,5-tetramethylheptan-3-yl)cyclohexen-1-yl]methanol.
| Compound Name | 1-[2-(4-cyclohexylcyclohex-2-en-1-yl)oxyethoxy]ethoxy-[2-methyl-4-(2,2,5,5-tetramethylheptan-3-yl)cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 123473451 |
| Molecular Formula | C35H62O4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | 1-[2-(4-cyclohexylcyclohex-2-en-1-yl)oxyethoxy]ethoxy-[2-methyl-4-(2,2,5,5-tetramethylheptan-3-yl)cyclohexen-1-yl]methanol |
| SMILES | CCC(C)(C)CC(C1CCC(C(O)OC(C)OCCOC2C=CC(C3CCCCC3)CC2)=C(C)C1)C(C)(C)C |
| InChI | InChI=1S/C35H62O4/c1-9-35(7,8)24-32(34(4,5)6)29-17-20-31(25(2)23-29)33(36)39-26(3)37-21-22-38-30-18-15-28(16-19-30)27-13-11-10-12-14-27/h15,18,26-30,32-33,36H,9-14,16-17,19-24H2,1-8H3 |
| InChIKey | JKQDQRDMPMTMSB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|