C25H34O4Si — CID 123473731
tert-butyl-diphenyl-[(2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methoxy]silane (PubChem CID 123473731) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methoxy]silane |
|---|---|
| PubChem CID | 123473731 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | tert-butyl-diphenyl-[(2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methoxy]silane |
| SMILES | CC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C25H34O4Si/c1-18-21(27-23-22(18)28-25(5,6)29-23)17-26-30(24(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23H,17H2,1-6H3 |
| InChIKey | FVQQNAYMLYODNG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|