C64H110O12 — CID 123474022
[1-hexadec-9-enoyloxy-3-(9-prop-2-enoyloxyoctadecanoyloxy)propan-2-yl] 9,13-di(prop-2-enoyloxy)octadecanoate (PubChem CID 123474022) has the molecular formula C64H110O12 and a molecular weight of 1071.57 g/mol. Its IUPAC name is [1-hexadec-9-enoyloxy-3-(9-prop-2-enoyloxyoctadecanoyloxy)propan-2-yl] 9,13-di(prop-2-enoyloxy)octadecanoate.
| Compound Name | [1-hexadec-9-enoyloxy-3-(9-prop-2-enoyloxyoctadecanoyloxy)propan-2-yl] 9,13-di(prop-2-enoyloxy)octadecanoate |
|---|---|
| PubChem CID | 123474022 |
| Molecular Formula | C64H110O12 |
| Molecular Weight | 1071.57 g/mol |
| Exact Mass | 1070.80 |
| IUPAC Name | [1-hexadec-9-enoyloxy-3-(9-prop-2-enoyloxyoctadecanoyloxy)propan-2-yl] 9,13-di(prop-2-enoyloxy)octadecanoate |
| SMILES | C=CC(=O)OC(CCCCCCCCC)CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC(CCCC(CCCCC)OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C64H110O12/c1-7-13-16-18-20-21-22-23-24-25-27-33-40-50-62(68)71-53-58(54-72-63(69)51-41-34-28-31-38-46-55(73-59(65)10-4)45-37-30-26-19-17-14-8-2)76-64(70)52-42-35-29-32-39-47-57(75-61(67)12-6)49-43-48-56(44-36-15-9-3)74-60(66)11-5/h10-12,21-22,55-58H,4-9,13-20,23-54H2,1-3H3 |
| InChIKey | OATNMDSQAVMSSU-UHFFFAOYSA-N |
| XLogP | 16.89 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.57 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|