C29H52O6 — CID 123474037
[(3R,4R,5R)-2-hexyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] octadeca-9,12-dienoate (PubChem CID 123474037) has the molecular formula C29H52O6 and a molecular weight of 496.73 g/mol. Its IUPAC name is [(3R,4R,5R)-2-hexyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] octadeca-9,12-dienoate.
| Compound Name | [(3R,4R,5R)-2-hexyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 123474037 |
| Molecular Formula | C29H52O6 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | [(3R,4R,5R)-2-hexyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC1(CCCCCC)O[C@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H52O6/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-26(31)35-29(23-21-8-6-4-2)28(33)27(32)25(24-30)34-29/h10-11,13-14,25,27-28,30,32-33H,3-9,12,15-24H2,1-2H3/t25-,27+,28-,29?/m1/s1 |
| InChIKey | XQTFTPKRGVNWQP-CUSFRNJBSA-N |
| XLogP | 6.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|