About N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide
N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 123474269) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide |
| PubChem CID | 123474269 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)N(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C10H15NO/c1-8-4-6-10(7-5-8)11(3)9(2)12/h4,6H,5,7H2,1-3H3 |
| InChIKey | RVMBGFRMKSRJTO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide?
The IUPAC name of N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide (CID 123474269) is N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide.
What is the SMILES notation for N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide?
The canonical SMILES for N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide is CC(=O)N(C)C1=CC=C(C)CC1.
What is the InChIKey of N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide?
The InChIKey is RVMBGFRMKSRJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-8-4-6-10(7-5-8)11(3)9(2)12/h4,6H,5,7H2,1-3H3.
What are the key properties of N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide?
N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide has a molecular weight of 165.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide is sourced from PubChem (CID 123474269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).