About 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine
2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine (PubChem CID 123474689) has the molecular formula C15H30F3N
and a molecular weight of 281.41 g/mol. Its IUPAC name is 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine |
| PubChem CID | 123474689 |
| Molecular Formula | C15H30F3N |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine |
| SMILES | CCC(CC(C)C)(CN(C(C)C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H30F3N/c1-8-14(9-11(2)3,15(16,17)18)10-19(12(4)5)13(6)7/h11-13H,8-10H2,1-7H3 |
| InChIKey | FAGFAMDIFQSSQM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine?
The IUPAC name of 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine (CID 123474689) is 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine.
What is the SMILES notation for 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine?
The canonical SMILES for 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine is CCC(CC(C)C)(CN(C(C)C)C(C)C)C(F)(F)F.
What is the InChIKey of 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine?
The InChIKey is FAGFAMDIFQSSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F3N/c1-8-14(9-11(2)3,15(16,17)18)10-19(12(4)5)13(6)7/h11-13H,8-10H2,1-7H3.
What are the key properties of 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine?
2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine has a molecular weight of 281.41 g/mol, XLogP of 5.11, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methyl-N,N-di(propan-2-yl)-2-(trifluoromethyl)pentan-1-amine is sourced from PubChem (CID 123474689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).