C11H23NO — CID 123474935
2-amino-3,6,7-trimethyloct-7-en-4-ol (PubChem CID 123474935) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-amino-3,6,7-trimethyloct-7-en-4-ol.
| Compound Name | 2-amino-3,6,7-trimethyloct-7-en-4-ol |
|---|---|
| PubChem CID | 123474935 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-amino-3,6,7-trimethyloct-7-en-4-ol |
| SMILES | C=C(C)C(C)CC(O)C(C)C(C)N |
| InChI | InChI=1S/C11H23NO/c1-7(2)8(3)6-11(13)9(4)10(5)12/h8-11,13H,1,6,12H2,2-5H3 |
| InChIKey | YGQMBYMKXOLKOV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|