C13H24N2O3S — CID 123475029
[1-[4-(2-methyl-2-sulfanylpropyl)piperazin-1-yl]-1-oxopropan-2-yl] acetate (PubChem CID 123475029) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is [1-[4-(2-methyl-2-sulfanylpropyl)piperazin-1-yl]-1-oxopropan-2-yl] acetate.
| Compound Name | [1-[4-(2-methyl-2-sulfanylpropyl)piperazin-1-yl]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 123475029 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [1-[4-(2-methyl-2-sulfanylpropyl)piperazin-1-yl]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(=O)N1CCN(CC(C)(C)S)CC1 |
| InChI | InChI=1S/C13H24N2O3S/c1-10(18-11(2)16)12(17)15-7-5-14(6-8-15)9-13(3,4)19/h10,19H,5-9H2,1-4H3 |
| InChIKey | HQWOOMNPYQALII-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|