About [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol
[4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol (PubChem CID 123475252) has the molecular formula C7H13F2NO2
and a molecular weight of 181.18 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol |
| PubChem CID | 123475252 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol |
| SMILES | OCC1CC(OCC(F)F)CN1 |
| InChI | InChI=1S/C7H13F2NO2/c8-7(9)4-12-6-1-5(3-11)10-2-6/h5-7,10-11H,1-4H2 |
| InChIKey | JZYIGAPRWAKJAZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol?
The IUPAC name of [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol (CID 123475252) is [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol?
The canonical SMILES for [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol is OCC1CC(OCC(F)F)CN1.
What is the InChIKey of [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol?
The InChIKey is JZYIGAPRWAKJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO2/c8-7(9)4-12-6-1-5(3-11)10-2-6/h5-7,10-11H,1-4H2.
What are the key properties of [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol?
[4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol has a molecular weight of 181.18 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethoxy)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 123475252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).