C24H33F3N2O — CID 123475484
3-[4-[methyl(propan-2-yl)amino]-2-(trifluoromethyl)penta-1,3-dien-3-yl]-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)oxiran-2-amine (PubChem CID 123475484) has the molecular formula C24H33F3N2O and a molecular weight of 422.54 g/mol. Its IUPAC name is 3-[4-[methyl(propan-2-yl)amino]-2-(trifluoromethyl)penta-1,3-dien-3-yl]-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)oxiran-2-amine.
| Compound Name | 3-[4-[methyl(propan-2-yl)amino]-2-(trifluoromethyl)penta-1,3-dien-3-yl]-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)oxiran-2-amine |
|---|---|
| PubChem CID | 123475484 |
| Molecular Formula | C24H33F3N2O |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 3-[4-[methyl(propan-2-yl)amino]-2-(trifluoromethyl)penta-1,3-dien-3-yl]-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)oxiran-2-amine |
| SMILES | C=C(C(=C(C)N(C)C(C)C)C1OC1Nc1cccc2c1C(C)CC2(C)C)C(F)(F)F |
| InChI | InChI=1S/C24H33F3N2O/c1-13(2)29(8)16(5)20(15(4)24(25,26)27)21-22(30-21)28-18-11-9-10-17-19(18)14(3)12-23(17,6)7/h9-11,13-14,21-22,28H,4,12H2,1-3,5-8H3 |
| InChIKey | FIEHXAHUBYUXBJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|