About 4a,4b-dihydrotriphenylene
4a,4b-dihydrotriphenylene (PubChem CID 123475523) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is 4a,4b-dihydrotriphenylene.
Molecular Properties
| Compound Name | 4a,4b-dihydrotriphenylene |
| PubChem CID | 123475523 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4a,4b-dihydrotriphenylene |
| SMILES | C1=CC2=c3ccccc3=C3C=CC=CC3C2C=C1 |
| InChI | InChI=1S/C18H14/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-13,15H |
| InChIKey | XPWNIGXDLGAIEB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4a,4b-dihydrotriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,4b-dihydrotriphenylene?
The IUPAC name of 4a,4b-dihydrotriphenylene (CID 123475523) is 4a,4b-dihydrotriphenylene.
What is the SMILES notation for 4a,4b-dihydrotriphenylene?
The canonical SMILES for 4a,4b-dihydrotriphenylene is C1=CC2=c3ccccc3=C3C=CC=CC3C2C=C1.
What is the InChIKey of 4a,4b-dihydrotriphenylene?
The InChIKey is XPWNIGXDLGAIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-13,15H.
What are the key properties of 4a,4b-dihydrotriphenylene?
4a,4b-dihydrotriphenylene has a molecular weight of 230.31 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,4b-dihydrotriphenylene is sourced from PubChem (CID 123475523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).