C29H46N2O2 — CID 123475563
N-(3-morpholin-4-ylpropyl)docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123475563) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123475563 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C29H46N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-29(32)30-23-21-24-31-25-27-33-28-26-31/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-28H2,1H3,(H,30,32) |
| InChIKey | UALIRAXJKFROHG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|