C20H15F2NO — CID 123475765
3-[2-[2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]benzaldehyde (PubChem CID 123475765) has the molecular formula C20H15F2NO and a molecular weight of 323.34 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]benzaldehyde.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]benzaldehyde |
|---|---|
| PubChem CID | 123475765 |
| Molecular Formula | C20H15F2NO |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]benzaldehyde |
| SMILES | O=Cc1cccc(-c2cccnc2CCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C20H15F2NO/c21-17-10-14(11-18(22)12-17)6-7-20-19(5-2-8-23-20)16-4-1-3-15(9-16)13-24/h1-5,8-13H,6-7H2 |
| InChIKey | YXXPVYCBYNKYKY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|