About ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate
ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate (PubChem CID 123476044) has the molecular formula C10H15F2NO3
and a molecular weight of 235.23 g/mol. Its IUPAC name is ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate |
| PubChem CID | 123476044 |
| Molecular Formula | C10H15F2NO3 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(CC)CC(F)(F)C1=O |
| InChI | InChI=1S/C10H15F2NO3/c1-3-13-5-7(9(15)16-4-2)8(14)10(11,12)6-13/h7H,3-6H2,1-2H3 |
| InChIKey | ZMRQETAJUUEYBL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate?
The IUPAC name of ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate (CID 123476044) is ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate?
The canonical SMILES for ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate is CCOC(=O)C1CN(CC)CC(F)(F)C1=O.
What is the InChIKey of ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate?
The InChIKey is ZMRQETAJUUEYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO3/c1-3-13-5-7(9(15)16-4-2)8(14)10(11,12)6-13/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate?
ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate has a molecular weight of 235.23 g/mol, XLogP of 0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-5,5-difluoro-4-oxopiperidine-3-carboxylate is sourced from PubChem (CID 123476044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).