About 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate
2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate (PubChem CID 123476155) has the molecular formula C20H40N2O2
and a molecular weight of 340.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate |
| PubChem CID | 123476155 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate |
| SMILES | CCN(CC)CCOC(=O)C(C)=CCCC(C)CCCC(C)(C)N |
| InChI | InChI=1S/C20H40N2O2/c1-7-22(8-2)15-16-24-19(23)18(4)13-9-11-17(3)12-10-14-20(5,6)21/h13,17H,7-12,14-16,21H2,1-6H3 |
| InChIKey | WGYMYLGWVRVSNE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate?
The IUPAC name of 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate (CID 123476155) is 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate.
What is the SMILES notation for 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate?
The canonical SMILES for 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate is CCN(CC)CCOC(=O)C(C)=CCCC(C)CCCC(C)(C)N.
What is the InChIKey of 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate?
The InChIKey is WGYMYLGWVRVSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2O2/c1-7-22(8-2)15-16-24-19(23)18(4)13-9-11-17(3)12-10-14-20(5,6)21/h13,17H,7-12,14-16,21H2,1-6H3.
What are the key properties of 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate?
2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate has a molecular weight of 340.55 g/mol, XLogP of 4.14, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 10-amino-2,6,10-trimethylundec-2-enoate is sourced from PubChem (CID 123476155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).