C21H18F2N2O3 — CID 123476384
3-[(2R)-2-[3-(2,6-difluorophenyl)prop-2-enoylamino]propyl]indole-1-carboxylic acid (PubChem CID 123476384) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is 3-[(2R)-2-[3-(2,6-difluorophenyl)prop-2-enoylamino]propyl]indole-1-carboxylic acid.
| Compound Name | 3-[(2R)-2-[3-(2,6-difluorophenyl)prop-2-enoylamino]propyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 123476384 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-[(2R)-2-[3-(2,6-difluorophenyl)prop-2-enoylamino]propyl]indole-1-carboxylic acid |
| SMILES | C[C@H](Cc1cn(C(=O)O)c2ccccc12)NC(=O)C=Cc1c(F)cccc1F |
| InChI | InChI=1S/C21H18F2N2O3/c1-13(24-20(26)10-9-16-17(22)6-4-7-18(16)23)11-14-12-25(21(27)28)19-8-3-2-5-15(14)19/h2-10,12-13H,11H2,1H3,(H,24,26)(H,27,28)/t13-/m1/s1 |
| InChIKey | CPJQYTNGOFUQOP-CYBMUJFWSA-N |
| XLogP | 4.21 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|