About 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine
3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine (PubChem CID 123476549) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 123476549 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine |
| SMILES | C/N=C1\CCC(F)C(F)=C1C |
| InChI | InChI=1S/C8H11F2N/c1-5-7(11-2)4-3-6(9)8(5)10/h6H,3-4H2,1-2H3/b11-7+ |
| InChIKey | ORRQUJYRDUGTSL-YRNVUSSQSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine?
The IUPAC name of 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine (CID 123476549) is 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine is C/N=C1\CCC(F)C(F)=C1C.
What is the InChIKey of 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine?
The InChIKey is ORRQUJYRDUGTSL-YRNVUSSQSA-N. The full InChI is InChI=1S/C8H11F2N/c1-5-7(11-2)4-3-6(9)8(5)10/h6H,3-4H2,1-2H3/b11-7+.
What are the key properties of 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine?
3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine has a molecular weight of 159.18 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-N,2-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 123476549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).