C25H39N3O2 — CID 123476810
4-N-ethyl-1-N-(2-methoxyethyl)-4-N-[2-methyl-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]cyclohexane-1,4-diamine (PubChem CID 123476810) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 4-N-ethyl-1-N-(2-methoxyethyl)-4-N-[2-methyl-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-ethyl-1-N-(2-methoxyethyl)-4-N-[2-methyl-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123476810 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 4-N-ethyl-1-N-(2-methoxyethyl)-4-N-[2-methyl-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]cyclohexane-1,4-diamine |
| SMILES | CCN(c1cc(C#CCN2CCOCC2)ccc1C)C1CCC(NCCOC)CC1 |
| InChI | InChI=1S/C25H39N3O2/c1-4-28(24-11-9-23(10-12-24)26-13-17-29-3)25-20-22(8-7-21(25)2)6-5-14-27-15-18-30-19-16-27/h7-8,20,23-24,26H,4,9-19H2,1-3H3 |
| InChIKey | GHRCEAFDZYZPLH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|