About 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine
1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine (PubChem CID 123476847) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine |
| PubChem CID | 123476847 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine |
| SMILES | CC=C(OC)C(=CC)OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C15H28N2O2/c1-5-14(18-4)15(6-2)19-13-7-8-17-11-9-16(3)10-12-17/h5-6H,7-13H2,1-4H3 |
| InChIKey | FOHIGZLHZLKAGX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine?
The IUPAC name of 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine (CID 123476847) is 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine.
What is the SMILES notation for 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine?
The canonical SMILES for 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine is CC=C(OC)C(=CC)OCCCN1CCN(C)CC1.
What is the InChIKey of 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine?
The InChIKey is FOHIGZLHZLKAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-5-14(18-4)15(6-2)19-13-7-8-17-11-9-16(3)10-12-17/h5-6H,7-13H2,1-4H3.
What are the key properties of 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine?
1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine has a molecular weight of 268.40 g/mol, XLogP of 2.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-methoxyhexa-2,4-dien-3-yloxy)propyl]-4-methylpiperazine is sourced from PubChem (CID 123476847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).