C14H19F3N2 — CID 123477171
2-[[4-(1,1,1-trifluoropropan-2-yl)cyclohex-2-en-1-ylidene]amino]pent-3-yn-1-amine (PubChem CID 123477171) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-[[4-(1,1,1-trifluoropropan-2-yl)cyclohex-2-en-1-ylidene]amino]pent-3-yn-1-amine.
| Compound Name | 2-[[4-(1,1,1-trifluoropropan-2-yl)cyclohex-2-en-1-ylidene]amino]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 123477171 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[[4-(1,1,1-trifluoropropan-2-yl)cyclohex-2-en-1-ylidene]amino]pent-3-yn-1-amine |
| SMILES | CC#CC(CN)/N=C1/C=CC(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N2/c1-3-4-13(9-18)19-12-7-5-11(6-8-12)10(2)14(15,16)17/h5,7,10-11,13H,6,8-9,18H2,1-2H3/b19-12- |
| InChIKey | YWQHUMIRXBGVMK-UNOMPAQXSA-N |
| XLogP | 2.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|