C12H13Cl2NO3S — CID 123477614
(4R,5R)-2-(dichloromethyl)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazole;sulfur dioxide (PubChem CID 123477614) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is (4R,5R)-2-(dichloromethyl)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazole;sulfur dioxide.
| Compound Name | (4R,5R)-2-(dichloromethyl)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazole;sulfur dioxide |
|---|---|
| PubChem CID | 123477614 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (4R,5R)-2-(dichloromethyl)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazole;sulfur dioxide |
| SMILES | Cc1ccc([C@H]2OC(C(Cl)Cl)=N[C@@H]2C)cc1.O=S=O |
| InChI | InChI=1S/C12H13Cl2NO.O2S/c1-7-3-5-9(6-4-7)10-8(2)15-12(16-10)11(13)14;1-3-2/h3-6,8,10-11H,1-2H3;/t8-,10+;/m1./s1 |
| InChIKey | MKEQPDRIESPOSP-SCYNACPDSA-N |
| XLogP | 2.99 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|