C30H31FN4O2 — CID 123477744
N-[1-(4-fluorophenyl)ethyl]-2-oxo-3-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxamide (PubChem CID 123477744) has the molecular formula C30H31FN4O2 and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-2-oxo-3-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-2-oxo-3-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 123477744 |
| Molecular Formula | C30H31FN4O2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-2-oxo-3-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)NC(=O)C2/C=N/c1ccc(CN2CCCCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H31FN4O2/c1-20(22-7-10-24(31)11-8-22)33-29(36)23-9-14-26-27(30(37)34-28(26)17-23)18-32-25-12-5-21(6-13-25)19-35-15-3-2-4-16-35/h5-14,17-18,20,27H,2-4,15-16,19H2,1H3,(H,33,36)(H,34,37)/b32-18+ |
| InChIKey | VGSBOCHDSBUUMM-KCSSXMTESA-N |
| XLogP | 5.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|