C12H23N3O2S3 — CID 123478201
1,3,5-tris(3-sulfanylpropyl)-1,3,5-triazinane-2,4-dione (PubChem CID 123478201) has the molecular formula C12H23N3O2S3 and a molecular weight of 337.54 g/mol. Its IUPAC name is 1,3,5-tris(3-sulfanylpropyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-tris(3-sulfanylpropyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 123478201 |
| Molecular Formula | C12H23N3O2S3 |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1,3,5-tris(3-sulfanylpropyl)-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1N(CCCS)CN(CCCS)C(=O)N1CCCS |
| InChI | InChI=1S/C12H23N3O2S3/c16-11-13(4-1-7-18)10-14(5-2-8-19)12(17)15(11)6-3-9-20/h18-20H,1-10H2 |
| InChIKey | VKYDOOUFFREJLO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|