C13H16BrNO2 — CID 123478301
8-bromo-5-ethyl-3,3-dimethyl-2H-1,5-benzoxazepin-4-one (PubChem CID 123478301) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 8-bromo-5-ethyl-3,3-dimethyl-2H-1,5-benzoxazepin-4-one.
| Compound Name | 8-bromo-5-ethyl-3,3-dimethyl-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 123478301 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 8-bromo-5-ethyl-3,3-dimethyl-2H-1,5-benzoxazepin-4-one |
| SMILES | CCN1C(=O)C(C)(C)COc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H16BrNO2/c1-4-15-10-6-5-9(14)7-11(10)17-8-13(2,3)12(15)16/h5-7H,4,8H2,1-3H3 |
| InChIKey | IEBKOOKMXLOWTP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |