C29H42FN5O2Si2 — CID 123478639
5-ethyl-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 123478639) has the molecular formula C29H42FN5O2Si2 and a molecular weight of 567.86 g/mol. Its IUPAC name is 5-ethyl-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-ethyl-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 123478639 |
| Molecular Formula | C29H42FN5O2Si2 |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 5-ethyl-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n2ncc(-c3cnc4ccc(F)cc4c3)c2n1 |
| InChI | InChI=1S/C29H42FN5O2Si2/c1-8-25-17-28(34(20-36-11-13-38(2,3)4)21-37-12-14-39(5,6)7)35-29(33-25)26(19-32-35)23-15-22-16-24(30)9-10-27(22)31-18-23/h9-10,15-19H,8,11-14,20-21H2,1-7H3 |
| InChIKey | IJFRIIWJAZSPRM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|