About 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine
3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine (PubChem CID 123478970) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine.
Molecular Properties
| Compound Name | 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine |
| PubChem CID | 123478970 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine |
| SMILES | NCC1=CC=NC2N=CCC12 |
| InChI | InChI=1S/C8H11N3/c9-5-6-1-3-10-8-7(6)2-4-11-8/h1,3-4,7-8H,2,5,9H2 |
| InChIKey | XVAWOYWYPVAFEX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine?
The IUPAC name of 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine (CID 123478970) is 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine.
What is the SMILES notation for 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine?
The canonical SMILES for 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine is NCC1=CC=NC2N=CCC12.
What is the InChIKey of 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine?
The InChIKey is XVAWOYWYPVAFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c9-5-6-1-3-10-8-7(6)2-4-11-8/h1,3-4,7-8H,2,5,9H2.
What are the key properties of 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine?
3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine has a molecular weight of 149.20 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-3H-pyrrolo[2,3-b]pyridin-4-ylmethanamine is sourced from PubChem (CID 123478970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).