C19H36N4 — CID 123479104
1,2,4,5-tetramethyl-3-[5-(2,3,4,5-tetramethyl-2H-imidazol-1-yl)pentyl]-2H-imidazole (PubChem CID 123479104) has the molecular formula C19H36N4 and a molecular weight of 320.53 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-[5-(2,3,4,5-tetramethyl-2H-imidazol-1-yl)pentyl]-2H-imidazole.
| Compound Name | 1,2,4,5-tetramethyl-3-[5-(2,3,4,5-tetramethyl-2H-imidazol-1-yl)pentyl]-2H-imidazole |
|---|---|
| PubChem CID | 123479104 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 1,2,4,5-tetramethyl-3-[5-(2,3,4,5-tetramethyl-2H-imidazol-1-yl)pentyl]-2H-imidazole |
| SMILES | CC1=C(C)N(CCCCCN2C(C)=C(C)N(C)C2C)C(C)N1C |
| InChI | InChI=1S/C19H36N4/c1-14-16(3)22(18(5)20(14)7)12-10-9-11-13-23-17(4)15(2)21(8)19(23)6/h18-19H,9-13H2,1-8H3 |
| InChIKey | WCGGAIATWORFBT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|