About (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite
(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite (PubChem CID 123479447) has the molecular formula C6H9N2O4S-
and a molecular weight of 205.21 g/mol. Its IUPAC name is (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite.
Molecular Properties
| Compound Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite |
| PubChem CID | 123479447 |
| Molecular Formula | C6H9N2O4S- |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite |
| SMILES | O=C1N2CCCC(C2)N1OS(=O)[O-] |
| InChI | InChI=1S/C6H10N2O4S/c9-6-7-3-1-2-5(4-7)8(6)12-13(10)11/h5H,1-4H2,(H,10,11)/p-1 |
| InChIKey | WUXQGFTYXFHNCJ-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite?
The IUPAC name of (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite (CID 123479447) is (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite.
What is the SMILES notation for (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite?
The canonical SMILES for (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite is O=C1N2CCCC(C2)N1OS(=O)[O-].
What is the InChIKey of (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite?
The InChIKey is WUXQGFTYXFHNCJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10N2O4S/c9-6-7-3-1-2-5(4-7)8(6)12-13(10)11/h5H,1-4H2,(H,10,11)/p-1.
What are the key properties of (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite?
(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite has a molecular weight of 205.21 g/mol, XLogP of -0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) sulfite is sourced from PubChem (CID 123479447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).