C12H8F5NO2 — CID 123479750
1-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole-2,5-diol (PubChem CID 123479750) has the molecular formula C12H8F5NO2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole-2,5-diol.
| Compound Name | 1-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123479750 |
| Molecular Formula | C12H8F5NO2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole-2,5-diol |
| SMILES | Cn1c(O)cc(Cc2c(F)c(F)c(F)c(F)c2F)c1O |
| InChI | InChI=1S/C12H8F5NO2/c1-18-6(19)3-4(12(18)20)2-5-7(13)9(15)11(17)10(16)8(5)14/h3,19-20H,2H2,1H3 |
| InChIKey | TUQZLVWTZRKPTO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|