About 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol
1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol (PubChem CID 123480180) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol |
| PubChem CID | 123480180 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol |
| SMILES | C=C(C=CC(=C)C(O)OC)OC |
| InChI | InChI=1S/C9H14O3/c1-7(9(10)12-4)5-6-8(2)11-3/h5-6,9-10H,1-2H2,3-4H3 |
| InChIKey | MWHRZGYMDXJWOL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol?
The IUPAC name of 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol (CID 123480180) is 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol.
What is the SMILES notation for 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol?
The canonical SMILES for 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol is C=C(C=CC(=C)C(O)OC)OC.
What is the InChIKey of 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol?
The InChIKey is MWHRZGYMDXJWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(9(10)12-4)5-6-8(2)11-3/h5-6,9-10H,1-2H2,3-4H3.
What are the key properties of 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol?
1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol has a molecular weight of 170.21 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethoxy-2-methylidenehexa-3,5-dien-1-ol is sourced from PubChem (CID 123480180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).