About propane;1-thia-4-azaspiro[5.5]undecane
propane;1-thia-4-azaspiro[5.5]undecane (PubChem CID 123480462) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is propane;1-thia-4-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | propane;1-thia-4-azaspiro[5.5]undecane |
| PubChem CID | 123480462 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | propane;1-thia-4-azaspiro[5.5]undecane |
| SMILES | C1CCC2(CC1)CNCCS2.CCC |
| InChI | InChI=1S/C9H17NS.C3H8/c1-2-4-9(5-3-1)8-10-6-7-11-9;1-3-2/h10H,1-8H2;3H2,1-2H3 |
| InChIKey | WSTMIVOLOUEYHH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane;1-thia-4-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;1-thia-4-azaspiro[5.5]undecane?
The IUPAC name of propane;1-thia-4-azaspiro[5.5]undecane (CID 123480462) is propane;1-thia-4-azaspiro[5.5]undecane.
What is the SMILES notation for propane;1-thia-4-azaspiro[5.5]undecane?
The canonical SMILES for propane;1-thia-4-azaspiro[5.5]undecane is C1CCC2(CC1)CNCCS2.CCC.
What is the InChIKey of propane;1-thia-4-azaspiro[5.5]undecane?
The InChIKey is WSTMIVOLOUEYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS.C3H8/c1-2-4-9(5-3-1)8-10-6-7-11-9;1-3-2/h10H,1-8H2;3H2,1-2H3.
What are the key properties of propane;1-thia-4-azaspiro[5.5]undecane?
propane;1-thia-4-azaspiro[5.5]undecane has a molecular weight of 215.41 g/mol, XLogP of 3.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;1-thia-4-azaspiro[5.5]undecane is sourced from PubChem (CID 123480462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).